Table 17.4
GC Operating Conditions to Determine Fatty Oil Composition [1,50]
Property | Specifications |
Carrier gas | Helium |
Linear velocity | 24.4 cm/sec |
Flow rate | 1.10 mL/min (column flow) |
Detector temperature | 260.0°C |
Column head pressure | 56.9 kPa |
Column dimension | BPX 70, 30.0 m × 0.25 μm × 0.32 mm ID |
Injector column oven | 240.0°C |
Temperature ramp | 140.0°C (hold for 2 min) |
8°C/min 165.0°C | |
3°C/min 192.0°C | |
8°C/min 220.0°C (hold for 5 min) |
Table 17.5
The Chemical Structures of Common Fatty Oil [8,18]
Fatty Oil | Structure | Systematic Name | Chemical Structure |
Lauric | (12:0) | Dodecanoic | CH3(CH2)10COOH |
Myristic | (14:0) | Tetradecanoic | CH3(CH2)12COOH |
Palmitic | (16:0) | Hexadecanoic | CH3(CH2)14COOH |
Palmitoleic | (16:1) | cis-9-Hexadecenoic | CH3(CH2)5CHCH(CH2)7COOH |
Stearic | (18:0) | Octadecanoic | CH3(CH2)16COOH |
Oleic | (18:1) | cis-9-Octadecenoic | CH3(CH2)7CHCH(CH2)7COOH |
Linoleic | (18:2) | cis-9-cis-12-Octadecadienoic | CH3(CH2)4CHCHCH2CHCH(CH2)7COOH |
Linolenic | (18:3) | cis-9-cis-12, | CH3CH2CHCHCH2CHCHCH2CHCH(CH2)7COOH |
Arachidic | (20:0) | Eicosanoic | CH3(CH2)18COOH |
Gondoic | (20:1) | cis-11-Eicosenoic | CH3(CH2)7CHCH(CH2)9COOH |
Behenic | (22:0) | Docosanoic | CH3(CH2)20COOH |
Erucic | (22:1) | cis-13-Docosenoic | CH3(CH2)7CHCH(CH2)11COOH |
Lignoceric | (24:0) | Tetracosanoic | CH3(CH2)22COOH |
Nervonic | (24:1) | cis-15-Tetracosenoic | CH3(CH2)7CHCH(CH2)13COOH |
Cerotic | (26:0) | Hexacosanoic | CH3(CH2)24COOH |